C14H18N2OS — CID 116967295
2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butan-1-amine (PubChem CID 116967295) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butan-1-amine.
| Compound Name | 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butan-1-amine |
|---|---|
| PubChem CID | 116967295 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]butan-1-amine |
| SMILES | CCC(CN)c1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C14H18N2OS/c1-3-10(8-15)14-16-13(9-18-14)11-4-6-12(17-2)7-5-11/h4-7,9-10H,3,8,15H2,1-2H3 |
| InChIKey | SSBYBJFDVDCIKH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |