C6H9N2OPS — CID 146247305
1-[2-[(R)-amino(phosphanyl)methyl]-1,3-thiazol-4-yl]ethanone (PubChem CID 146247305) has the molecular formula C6H9N2OPS and a molecular weight of 188.19 g/mol. Its IUPAC name is 1-[2-[(R)-amino(phosphanyl)methyl]-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-[(R)-amino(phosphanyl)methyl]-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 146247305 |
| Molecular Formula | C6H9N2OPS |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 1-[2-[(R)-amino(phosphanyl)methyl]-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc([C@H](N)P)n1 |
| InChI | InChI=1S/C6H9N2OPS/c1-3(9)4-2-11-6(8-4)5(7)10/h2,5H,7,10H2,1H3/t5-/m1/s1 |
| InChIKey | QJMIKMIRRSHWFD-RXMQYKEDSA-N |
| XLogP | 1.18 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|