C12H12N2OS — CID 116585747
[2-(1-aminoethyl)-1,3-thiazol-4-yl]-phenylmethanone (PubChem CID 116585747) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is [2-(1-aminoethyl)-1,3-thiazol-4-yl]-phenylmethanone.
| Compound Name | [2-(1-aminoethyl)-1,3-thiazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 116585747 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | [2-(1-aminoethyl)-1,3-thiazol-4-yl]-phenylmethanone |
| SMILES | CC(N)c1nc(C(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C12H12N2OS/c1-8(13)12-14-10(7-16-12)11(15)9-5-3-2-4-6-9/h2-8H,13H2,1H3 |
| InChIKey | DECGJWPETAWSNA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |