C13H19NO2S — CID 116774203
1-[2-[cyclohexyl(methoxy)methyl]-1,3-thiazol-4-yl]ethanone (PubChem CID 116774203) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-[2-[cyclohexyl(methoxy)methyl]-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-[cyclohexyl(methoxy)methyl]-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 116774203 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-[2-[cyclohexyl(methoxy)methyl]-1,3-thiazol-4-yl]ethanone |
| SMILES | COC(c1nc(C(C)=O)cs1)C1CCCCC1 |
| InChI | InChI=1S/C13H19NO2S/c1-9(15)11-8-17-13(14-11)12(16-2)10-6-4-3-5-7-10/h8,10,12H,3-7H2,1-2H3 |
| InChIKey | GZIAEJSIKAPJCQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |