C10H13NO2S — CID 86812908
[(E)-pent-2-enyl] 2-methyl-1,3-thiazole-4-carboxylate (PubChem CID 86812908) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is [(E)-pent-2-enyl] 2-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | [(E)-pent-2-enyl] 2-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 86812908 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | [(E)-pent-2-enyl] 2-methyl-1,3-thiazole-4-carboxylate |
| SMILES | CC/C=C/COC(=O)c1csc(C)n1 |
| InChI | InChI=1S/C10H13NO2S/c1-3-4-5-6-13-10(12)9-7-14-8(2)11-9/h4-5,7H,3,6H2,1-2H3/b5-4+ |
| InChIKey | NQSOONNWUOWTAU-SNAWJCMRSA-N |
| XLogP | 2.57 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|