C11H10F3NO2S2 — CID 106432441
5-(3-hydroxyprop-1-ynyl)-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-3-carboxamide (PubChem CID 106432441) has the molecular formula C11H10F3NO2S2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-3-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 106432441 |
| Molecular Formula | C11H10F3NO2S2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C11H10F3NO2S2/c12-11(13,14)19-5-3-15-10(17)8-6-9(18-7-8)2-1-4-16/h6-7,16H,3-5H2,(H,15,17) |
| InChIKey | CTEDRWFPSZCODB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|