C10H13NO4S — CID 30583271
N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]furan-3-carboxamide (PubChem CID 30583271) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]furan-3-carboxamide.
| Compound Name | N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 30583271 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]furan-3-carboxamide |
| SMILES | C[C@@]1(NC(=O)c2ccoc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13NO4S/c1-10(3-5-16(13,14)7-10)11-9(12)8-2-4-15-6-8/h2,4,6H,3,5,7H2,1H3,(H,11,12)/t10-/m1/s1 |
| InChIKey | VKNZFMDBCJXGKY-SNVBAGLBSA-N |
| XLogP | 0.59 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |