C10H12ClNO4S — CID 51183630
5-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-2-carboxamide (PubChem CID 51183630) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is 5-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 51183630 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 5-chloro-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-2-carboxamide |
| SMILES | CC1(NC(=O)c2ccc(Cl)o2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H12ClNO4S/c1-10(4-5-17(14,15)6-10)12-9(13)7-2-3-8(11)16-7/h2-3H,4-6H2,1H3,(H,12,13) |
| InChIKey | ZORWORYTALNRBP-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |