C12H13ClFNO3S — CID 78790417
2-chloro-4-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide (PubChem CID 78790417) has the molecular formula C12H13ClFNO3S and a molecular weight of 305.76 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 2-chloro-4-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 78790417 |
| Molecular Formula | C12H13ClFNO3S |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-chloro-4-fluoro-N-(3-methyl-1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CC1(NC(=O)c2ccc(F)cc2Cl)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13ClFNO3S/c1-12(4-5-19(17,18)7-12)15-11(16)9-3-2-8(14)6-10(9)13/h2-3,6H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | QEZPRLQNLORIKD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |