C10H12BrNO4S — CID 106853081
2-bromo-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-3-carboxamide (PubChem CID 106853081) has the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. Its IUPAC name is 2-bromo-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106853081 |
| Molecular Formula | C10H12BrNO4S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 320.97 |
| IUPAC Name | 2-bromo-N-(3-methyl-1,1-dioxothiolan-3-yl)furan-3-carboxamide |
| SMILES | CC1(NC(=O)c2ccoc2Br)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H12BrNO4S/c1-10(3-5-17(14,15)6-10)12-9(13)7-2-4-16-8(7)11/h2,4H,3,5-6H2,1H3,(H,12,13) |
| InChIKey | CCQJELDWFLNYCT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |