C14H16N2O3S — CID 61275040
N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-indole-4-carboxamide (PubChem CID 61275040) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-indole-4-carboxamide.
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 61275040 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-1H-indole-4-carboxamide |
| SMILES | CC1(NC(=O)c2cccc3[nH]ccc23)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N2O3S/c1-14(6-8-20(18,19)9-14)16-13(17)11-3-2-4-12-10(11)5-7-15-12/h2-5,7,15H,6,8-9H2,1H3,(H,16,17) |
| InChIKey | MVBNTVBLLFIEKK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |