C13H18FNOS2 — CID 107036007
N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-sulfanylbenzamide (PubChem CID 107036007) has the molecular formula C13H18FNOS2 and a molecular weight of 287.43 g/mol. Its IUPAC name is N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-sulfanylbenzamide.
| Compound Name | N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107036007 |
| Molecular Formula | C13H18FNOS2 |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-(4-ethylsulfanylbutan-2-yl)-4-fluoro-3-sulfanylbenzamide |
| SMILES | CCSCCC(C)NC(=O)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C13H18FNOS2/c1-3-18-7-6-9(2)15-13(16)10-4-5-11(14)12(17)8-10/h4-5,8-9,17H,3,6-7H2,1-2H3,(H,15,16) |
| InChIKey | GKGVOQGYUXEFIW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|