About N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide
N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 65239032) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide |
| PubChem CID | 65239032 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCC(C)N)sc1C |
| InChI | InChI=1S/C11H18N2OS/c1-7-6-10(15-9(7)3)11(14)13-5-4-8(2)12/h6,8H,4-5,12H2,1-3H3,(H,13,14) |
| InChIKey | KDGSHUZGGPJHSA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide?
The IUPAC name of N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide (CID 65239032) is N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide.
What is the SMILES notation for N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide?
The canonical SMILES for N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide is Cc1cc(C(=O)NCCC(C)N)sc1C.
What is the InChIKey of N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide?
The InChIKey is KDGSHUZGGPJHSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-7-6-10(15-9(7)3)11(14)13-5-4-8(2)12/h6,8H,4-5,12H2,1-3H3,(H,13,14).
What are the key properties of N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide?
N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide has a molecular weight of 226.34 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminobutyl)-4,5-dimethylthiophene-2-carboxamide is sourced from PubChem (CID 65239032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).