C11H16N2OS2 — CID 65239005
N-(4-amino-4-sulfanylidenebutyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 65239005) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutyl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutyl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 65239005 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCC(N)=S)sc1C |
| InChI | InChI=1S/C11H16N2OS2/c1-7-6-9(16-8(7)2)11(14)13-5-3-4-10(12)15/h6H,3-5H2,1-2H3,(H2,12,15)(H,13,14) |
| InChIKey | CPIWMUXIXZIUDW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|