C12H18N2OS2 — CID 65239054
N-(1-amino-1-sulfanylidenepentan-3-yl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 65239054) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepentan-3-yl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 65239054 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepentan-3-yl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | CCC(CC(N)=S)NC(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C12H18N2OS2/c1-4-9(6-11(13)16)14-12(15)10-5-7(2)8(3)17-10/h5,9H,4,6H2,1-3H3,(H2,13,16)(H,14,15) |
| InChIKey | ORJXPZGSMGOUJC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|