C13H17NOS — CID 103529059
N-hex-1-yn-3-yl-4,5-dimethylthiophene-2-carboxamide (PubChem CID 103529059) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is N-hex-1-yn-3-yl-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-hex-1-yn-3-yl-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103529059 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-hex-1-yn-3-yl-4,5-dimethylthiophene-2-carboxamide |
| SMILES | C#CC(CCC)NC(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C13H17NOS/c1-5-7-11(6-2)14-13(15)12-8-9(3)10(4)16-12/h2,8,11H,5,7H2,1,3-4H3,(H,14,15) |
| InChIKey | QJHGKNLZWXAZKZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|