C12H19NO2S2 — CID 103767606
N-[2-(3-hydroxypropylsulfanyl)ethyl]-4,5-dimethylthiophene-2-carboxamide (PubChem CID 103767606) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103767606 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCSCCCO)sc1C |
| InChI | InChI=1S/C12H19NO2S2/c1-9-8-11(17-10(9)2)12(15)13-4-7-16-6-3-5-14/h8,14H,3-7H2,1-2H3,(H,13,15) |
| InChIKey | OZEYGIGEADVLFI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|