C11H16N2O2S — CID 30596154
N-(2-acetamidoethyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 30596154) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 30596154 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(2-acetamidoethyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C11H16N2O2S/c1-7-6-10(16-8(7)2)11(15)13-5-4-12-9(3)14/h6H,4-5H2,1-3H3,(H,12,14)(H,13,15) |
| InChIKey | YDXGZDBHLFCGFO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|