C10H14ClNOS — CID 114296674
N-(2-chloropropyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 114296674) has the molecular formula C10H14ClNOS and a molecular weight of 231.75 g/mol. Its IUPAC name is N-(2-chloropropyl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(2-chloropropyl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 114296674 |
| Molecular Formula | C10H14ClNOS |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | N-(2-chloropropyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)Cl)sc1C |
| InChI | InChI=1S/C10H14ClNOS/c1-6-4-9(14-8(6)3)10(13)12-5-7(2)11/h4,7H,5H2,1-3H3,(H,12,13) |
| InChIKey | KRXNOAHUVVRNGE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|