C14H22N2O2S — CID 47168421
4,5-dimethyl-N-(2-morpholin-4-ylpropyl)thiophene-2-carboxamide (PubChem CID 47168421) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 4,5-dimethyl-N-(2-morpholin-4-ylpropyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dimethyl-N-(2-morpholin-4-ylpropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47168421 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4,5-dimethyl-N-(2-morpholin-4-ylpropyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)N2CCOCC2)sc1C |
| InChI | InChI=1S/C14H22N2O2S/c1-10-8-13(19-12(10)3)14(17)15-9-11(2)16-4-6-18-7-5-16/h8,11H,4-7,9H2,1-3H3,(H,15,17) |
| InChIKey | ZTNCWZZDDNTVFE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |