C20H26N2OS — CID 125434439
4-methyl-5-phenyl-N-[(2R)-2-piperidin-1-ylpropyl]thiophene-2-carboxamide (PubChem CID 125434439) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 4-methyl-5-phenyl-N-[(2R)-2-piperidin-1-ylpropyl]thiophene-2-carboxamide.
| Compound Name | 4-methyl-5-phenyl-N-[(2R)-2-piperidin-1-ylpropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 125434439 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-methyl-5-phenyl-N-[(2R)-2-piperidin-1-ylpropyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NC[C@@H](C)N2CCCCC2)sc1-c1ccccc1 |
| InChI | InChI=1S/C20H26N2OS/c1-15-13-18(24-19(15)17-9-5-3-6-10-17)20(23)21-14-16(2)22-11-7-4-8-12-22/h3,5-6,9-10,13,16H,4,7-8,11-12,14H2,1-2H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | GUNUPZINOXOFMF-MRXNPFEDSA-N |
| XLogP | 4.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |