C10H15NO2S — CID 43391417
N-(3-hydroxypropyl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 43391417) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 43391417 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | N-(3-hydroxypropyl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCO)sc1C |
| InChI | InChI=1S/C10H15NO2S/c1-7-6-9(14-8(7)2)10(13)11-4-3-5-12/h6,12H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | NOKYKPWMADLVLL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|