C13H18FNO5S — CID 102979048
(3-methoxy-3-methylbutyl) 3-fluoro-5-sulfamoylbenzoate (PubChem CID 102979048) has the molecular formula C13H18FNO5S and a molecular weight of 319.35 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) 3-fluoro-5-sulfamoylbenzoate.
| Compound Name | (3-methoxy-3-methylbutyl) 3-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 102979048 |
| Molecular Formula | C13H18FNO5S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (3-methoxy-3-methylbutyl) 3-fluoro-5-sulfamoylbenzoate |
| SMILES | COC(C)(C)CCOC(=O)c1cc(F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H18FNO5S/c1-13(2,19-3)4-5-20-12(16)9-6-10(14)8-11(7-9)21(15,17)18/h6-8H,4-5H2,1-3H3,(H2,15,17,18) |
| InChIKey | MALUAQDZQPIPDV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |