About (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate
(3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate (PubChem CID 106668652) has the molecular formula C13H17ClO5S
and a molecular weight of 320.79 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate.
Molecular Properties
| Compound Name | (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate |
| PubChem CID | 106668652 |
| Molecular Formula | C13H17ClO5S |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate |
| SMILES | COC(C)(C)CCOC(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H17ClO5S/c1-13(2,18-3)7-8-19-12(15)10-5-4-6-11(9-10)20(14,16)17/h4-6,9H,7-8H2,1-3H3 |
| InChIKey | QXNWUSNVMJUWSF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate?
The IUPAC name of (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate (CID 106668652) is (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate.
What is the SMILES notation for (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate?
The canonical SMILES for (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate is COC(C)(C)CCOC(=O)c1cccc(S(=O)(=O)Cl)c1.
What is the InChIKey of (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate?
The InChIKey is QXNWUSNVMJUWSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO5S/c1-13(2,18-3)7-8-19-12(15)10-5-4-6-11(9-10)20(14,16)17/h4-6,9H,7-8H2,1-3H3.
What are the key properties of (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate?
(3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate has a molecular weight of 320.79 g/mol, XLogP of 2.59, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-3-methylbutyl) 3-chlorosulfonylbenzoate is sourced from PubChem (CID 106668652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).