C12H16BrNO3 — CID 102979052
(3-methoxy-3-methylbutyl) 2-bromopyridine-4-carboxylate (PubChem CID 102979052) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) 2-bromopyridine-4-carboxylate.
| Compound Name | (3-methoxy-3-methylbutyl) 2-bromopyridine-4-carboxylate |
|---|---|
| PubChem CID | 102979052 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (3-methoxy-3-methylbutyl) 2-bromopyridine-4-carboxylate |
| SMILES | COC(C)(C)CCOC(=O)c1ccnc(Br)c1 |
| InChI | InChI=1S/C12H16BrNO3/c1-12(2,16-3)5-7-17-11(15)9-4-6-14-10(13)8-9/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | PHAJZIIYJODQJI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|