C12H13F3O6S — CID 130398566
3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylbenzenesulfonic acid (PubChem CID 130398566) has the molecular formula C12H13F3O6S and a molecular weight of 342.29 g/mol. Its IUPAC name is 3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylbenzenesulfonic acid.
| Compound Name | 3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 130398566 |
| Molecular Formula | C12H13F3O6S |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylbenzenesulfonic acid |
| SMILES | CC(O)(CCOC(=O)c1cccc(S(=O)(=O)O)c1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O6S/c1-11(17,12(13,14)15)5-6-21-10(16)8-3-2-4-9(7-8)22(18,19)20/h2-4,7,17H,5-6H2,1H3,(H,18,19,20) |
| InChIKey | LLESILUUAFHHFA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|