C20H14F6O9S2 — CID 121444694
3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1,5-disulfonic acid (PubChem CID 121444694) has the molecular formula C20H14F6O9S2 and a molecular weight of 576.45 g/mol. Its IUPAC name is 3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1,5-disulfonic acid.
| Compound Name | 3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 121444694 |
| Molecular Formula | C20H14F6O9S2 |
| Molecular Weight | 576.45 g/mol |
| Exact Mass | 576.00 |
| IUPAC Name | 3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1,5-disulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1cc(S(=O)(=O)O)c2cc3cccc(S(=O)(=O)O)c3cc2c1 |
| InChI | InChI=1S/C20H14F6O9S2/c21-19(22,23)18(28,20(24,25)26)4-5-35-17(27)12-6-11-8-13-10(2-1-3-15(13)36(29,30)31)7-14(11)16(9-12)37(32,33)34/h1-3,6-9,28H,4-5H2,(H,29,30,31)(H,32,33,34) |
| InChIKey | FWMGVNDNPHZLNK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|