C21H13F6NO6S — CID 140782552
6-isocyano-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid (PubChem CID 140782552) has the molecular formula C21H13F6NO6S and a molecular weight of 521.39 g/mol. Its IUPAC name is 6-isocyano-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid.
| Compound Name | 6-isocyano-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid |
|---|---|
| PubChem CID | 140782552 |
| Molecular Formula | C21H13F6NO6S |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 6-isocyano-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid |
| SMILES | [C-]#[N+]c1ccc2cc3c(S(=O)(=O)O)cc(C(=O)OCCC(O)(C(F)(F)F)C(F)(F)F)cc3cc2c1 |
| InChI | InChI=1S/C21H13F6NO6S/c1-28-15-3-2-11-9-16-13(6-12(11)8-15)7-14(10-17(16)35(31,32)33)18(29)34-5-4-19(30,20(22,23)24)21(25,26)27/h2-3,6-10,30H,4-5H2,(H,31,32,33) |
| InChIKey | LBAHZUFCPIHBAJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|