C28H18F12O9S — CID 121447822
5,9-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]pyrene-1-sulfonic acid (PubChem CID 121447822) has the molecular formula C28H18F12O9S and a molecular weight of 758.49 g/mol. Its IUPAC name is 5,9-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]pyrene-1-sulfonic acid.
| Compound Name | 5,9-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]pyrene-1-sulfonic acid |
|---|---|
| PubChem CID | 121447822 |
| Molecular Formula | C28H18F12O9S |
| Molecular Weight | 758.49 g/mol |
| Exact Mass | 758.05 |
| IUPAC Name | 5,9-bis[[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl]pyrene-1-sulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1cc2ccc(S(=O)(=O)O)c3cc(C(=O)OCCC(O)(C(F)(F)F)C(F)(F)F)c4cccc1c4c23 |
| InChI | InChI=1S/C28H18F12O9S/c29-25(30,31)23(43,26(32,33)34)6-8-48-21(41)15-10-12-4-5-18(50(45,46)47)17-11-16(14-3-1-2-13(15)20(14)19(12)17)22(42)49-9-7-24(44,27(35,36)37)28(38,39)40/h1-5,10-11,43-44H,6-9H2,(H,45,46,47) |
| InChIKey | PQNIMPWSHLMNLX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.49 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|