C6H6ClNO3S2 — CID 79807645
4-carbamoyl-3-methylthiophene-2-sulfonyl chloride (PubChem CID 79807645) has the molecular formula C6H6ClNO3S2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 4-carbamoyl-3-methylthiophene-2-sulfonyl chloride.
| Compound Name | 4-carbamoyl-3-methylthiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 79807645 |
| Molecular Formula | C6H6ClNO3S2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 238.95 |
| IUPAC Name | 4-carbamoyl-3-methylthiophene-2-sulfonyl chloride |
| SMILES | Cc1c(C(N)=O)csc1S(=O)(=O)Cl |
| InChI | InChI=1S/C6H6ClNO3S2/c1-3-4(5(8)9)2-12-6(3)13(7,10)11/h2H,1H3,(H2,8,9) |
| InChIKey | NFKVNFTUUYTUKH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |