C12H13ClO3S — CID 82910392
4-but-3-ynoxy-2,5-dimethylbenzenesulfonyl chloride (PubChem CID 82910392) has the molecular formula C12H13ClO3S and a molecular weight of 272.75 g/mol. Its IUPAC name is 4-but-3-ynoxy-2,5-dimethylbenzenesulfonyl chloride.
| Compound Name | 4-but-3-ynoxy-2,5-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82910392 |
| Molecular Formula | C12H13ClO3S |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 4-but-3-ynoxy-2,5-dimethylbenzenesulfonyl chloride |
| SMILES | C#CCCOc1cc(C)c(S(=O)(=O)Cl)cc1C |
| InChI | InChI=1S/C12H13ClO3S/c1-4-5-6-16-11-7-10(3)12(8-9(11)2)17(13,14)15/h1,7-8H,5-6H2,2-3H3 |
| InChIKey | GMHAODCZLQPPEZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|