C11H13ClO5S — CID 99109854
methyl 2-(4-chlorosulfonyl-2,5-dimethylphenoxy)acetate (PubChem CID 99109854) has the molecular formula C11H13ClO5S and a molecular weight of 292.74 g/mol. Its IUPAC name is methyl 2-(4-chlorosulfonyl-2,5-dimethylphenoxy)acetate.
| Compound Name | methyl 2-(4-chlorosulfonyl-2,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 99109854 |
| Molecular Formula | C11H13ClO5S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | methyl 2-(4-chlorosulfonyl-2,5-dimethylphenoxy)acetate |
| SMILES | COC(=O)COc1cc(C)c(S(=O)(=O)Cl)cc1C |
| InChI | InChI=1S/C11H13ClO5S/c1-7-5-10(18(12,14)15)8(2)4-9(7)17-6-11(13)16-3/h4-5H,6H2,1-3H3 |
| InChIKey | KRYOKDHAFOOXFY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |