4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride

C16H25ClO3S — CID 78974790

IUPAC4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride
SMILESCCCCC(CC)COc1cc(C)c(S(=O)(=O)Cl)cc1C
InChIInChI=1S/C16H25ClO3S/c1-5-7-8-14(6-2)11-20-15-9-13(4)16(10-12(15)3)21(17,18)19/h9-10,14H,5-8,11H2,1-4H3
InChIKeySHWNNYOOVBOVKI-UHFFFAOYSA-N
MW332.89 g/mol
LogP4.83
Rot. Bonds8

About 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride

4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride (PubChem CID 78974790) has the molecular formula C16H25ClO3S and a molecular weight of 332.89 g/mol. Its IUPAC name is 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride.

Molecular Properties

Compound Name4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride
PubChem CID78974790
Molecular FormulaC16H25ClO3S
Molecular Weight332.89 g/mol
Exact Mass332.12
IUPAC Name4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride
SMILESCCCCC(CC)COc1cc(C)c(S(=O)(=O)Cl)cc1C
InChIInChI=1S/C16H25ClO3S/c1-5-7-8-14(6-2)11-20-15-9-13(4)16(10-12(15)3)21(17,18)19/h9-10,14H,5-8,11H2,1-4H3
InChIKeySHWNNYOOVBOVKI-UHFFFAOYSA-N
XLogP4.83
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.89
LogP ≤ 54.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride?
The IUPAC name of 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride (CID 78974790) is 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride.
What is the SMILES notation for 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride?
The canonical SMILES for 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride is CCCCC(CC)COc1cc(C)c(S(=O)(=O)Cl)cc1C.
What is the InChIKey of 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride?
The InChIKey is SHWNNYOOVBOVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClO3S/c1-5-7-8-14(6-2)11-20-15-9-13(4)16(10-12(15)3)21(17,18)19/h9-10,14H,5-8,11H2,1-4H3.
What are the key properties of 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride?
4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride has a molecular weight of 332.89 g/mol, XLogP of 4.83, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride is sourced from PubChem (CID 78974790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).