C16H25ClO3S — CID 78974790
4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride (PubChem CID 78974790) has the molecular formula C16H25ClO3S and a molecular weight of 332.89 g/mol. Its IUPAC name is 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride.
| Compound Name | 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 78974790 |
| Molecular Formula | C16H25ClO3S |
| Molecular Weight | 332.89 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 4-(2-ethylhexoxy)-2,5-dimethylbenzenesulfonyl chloride |
| SMILES | CCCCC(CC)COc1cc(C)c(S(=O)(=O)Cl)cc1C |
| InChI | InChI=1S/C16H25ClO3S/c1-5-7-8-14(6-2)11-20-15-9-13(4)16(10-12(15)3)21(17,18)19/h9-10,14H,5-8,11H2,1-4H3 |
| InChIKey | SHWNNYOOVBOVKI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.89 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |