C11H11Cl3O3S — CID 82910055
2,3-dichloro-4-(2-methylidenebutoxy)benzenesulfonyl chloride (PubChem CID 82910055) has the molecular formula C11H11Cl3O3S and a molecular weight of 329.63 g/mol. Its IUPAC name is 2,3-dichloro-4-(2-methylidenebutoxy)benzenesulfonyl chloride.
| Compound Name | 2,3-dichloro-4-(2-methylidenebutoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82910055 |
| Molecular Formula | C11H11Cl3O3S |
| Molecular Weight | 329.63 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 2,3-dichloro-4-(2-methylidenebutoxy)benzenesulfonyl chloride |
| SMILES | C=C(CC)COc1ccc(S(=O)(=O)Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl3O3S/c1-3-7(2)6-17-8-4-5-9(18(14,15)16)11(13)10(8)12/h4-5H,2-3,6H2,1H3 |
| InChIKey | XGGVZLYLVZHONK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|