C12H10ClNO5S — CID 43115657
3-(5-chlorosulfonylquinolin-8-yl)oxypropanoic acid (PubChem CID 43115657) has the molecular formula C12H10ClNO5S and a molecular weight of 315.73 g/mol. Its IUPAC name is 3-(5-chlorosulfonylquinolin-8-yl)oxypropanoic acid.
| Compound Name | 3-(5-chlorosulfonylquinolin-8-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 43115657 |
| Molecular Formula | C12H10ClNO5S |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 3-(5-chlorosulfonylquinolin-8-yl)oxypropanoic acid |
| SMILES | O=C(O)CCOc1ccc(S(=O)(=O)Cl)c2cccnc12 |
| InChI | InChI=1S/C12H10ClNO5S/c13-20(17,18)10-4-3-9(19-7-5-11(15)16)12-8(10)2-1-6-14-12/h1-4,6H,5,7H2,(H,15,16) |
| InChIKey | YBEQPLJAJQHGKI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |