C11H15Cl2NO2 — CID 107497934
4,5-dichloro-2-(3-ethoxypropoxy)aniline (PubChem CID 107497934) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 4,5-dichloro-2-(3-ethoxypropoxy)aniline.
| Compound Name | 4,5-dichloro-2-(3-ethoxypropoxy)aniline |
|---|---|
| PubChem CID | 107497934 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4,5-dichloro-2-(3-ethoxypropoxy)aniline |
| SMILES | CCOCCCOc1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C11H15Cl2NO2/c1-2-15-4-3-5-16-11-7-9(13)8(12)6-10(11)14/h6-7H,2-5,14H2,1H3 |
| InChIKey | QEQSYVXIDQDSED-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|