C17H21Cl2N5O2 — CID 78363753
N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]tetrazolidin-5-amine (PubChem CID 78363753) has the molecular formula C17H21Cl2N5O2 and a molecular weight of 398.29 g/mol. Its IUPAC name is N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]tetrazolidin-5-amine.
| Compound Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]tetrazolidin-5-amine |
|---|---|
| PubChem CID | 78363753 |
| Molecular Formula | C17H21Cl2N5O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]tetrazolidin-5-amine |
| SMILES | CCOc1cc(CNC2NNNN2)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21Cl2N5O2/c1-2-25-15-8-12(9-20-17-21-23-24-22-17)7-14(19)16(15)26-10-11-3-5-13(18)6-4-11/h3-8,17,20-24H,2,9-10H2,1H3 |
| InChIKey | LKVIGKOAPNZTES-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |