C26H27IN2O3 — CID 126209254
2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126209254) has the molecular formula C26H27IN2O3 and a molecular weight of 542.42 g/mol. Its IUPAC name is 2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126209254 |
| Molecular Formula | C26H27IN2O3 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.11 |
| IUPAC Name | 2-[4-[(2,5-dimethylphenyl)iminomethyl]-2-ethoxy-6-iodophenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N/c2cc(C)ccc2C)cc(I)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C26H27IN2O3/c1-5-31-24-14-20(15-28-23-12-18(3)9-10-19(23)4)13-22(27)26(24)32-16-25(30)29-21-8-6-7-17(2)11-21/h6-15H,5,16H2,1-4H3,(H,29,30)/b28-15+ |
| InChIKey | UTMMAWCWCJMQGG-RWPZCVJISA-N |
| XLogP | 6.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|