C25H25ClN2O4 — CID 126224022
2-[2-chloro-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide (PubChem CID 126224022) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126224022 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenoxy]-N-(3-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=N/c2ccc(OC)cc2)cc(Cl)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C25H25ClN2O4/c1-4-31-23-14-18(15-27-19-8-10-21(30-3)11-9-19)13-22(26)25(23)32-16-24(29)28-20-7-5-6-17(2)12-20/h5-15H,4,16H2,1-3H3,(H,28,29)/b27-15+ |
| InChIKey | XBDCQLMKJKVODD-JFLMPSFJSA-N |
| XLogP | 5.82 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|