C21H15BrCl2I2N2O — CID 19059926
N-[(E)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine (PubChem CID 19059926) has the molecular formula C21H15BrCl2I2N2O and a molecular weight of 715.98 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 19059926 |
| Molecular Formula | C21H15BrCl2I2N2O |
| Molecular Weight | 715.98 g/mol |
| Exact Mass | 713.78 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
| SMILES | Clc1cccc(Cl)c1CN/N=C/c1cc(I)c(OCc2ccc(Br)cc2)c(I)c1 |
| InChI | InChI=1S/C21H15BrCl2I2N2O/c22-15-6-4-13(5-7-15)12-29-21-19(25)8-14(9-20(21)26)10-27-28-11-16-17(23)2-1-3-18(16)24/h1-10,28H,11-12H2/b27-10+ |
| InChIKey | XQZMDKGJRTZHPX-YPXUMCKCSA-N |
| XLogP | 7.67 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.98 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|