C15H15BrN2O — CID 17245736
N-[(E)-(3-bromophenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 17245736) has the molecular formula C15H15BrN2O and a molecular weight of 319.20 g/mol. Its IUPAC name is N-[(E)-(3-bromophenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(E)-(3-bromophenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 17245736 |
| Molecular Formula | C15H15BrN2O |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-[(E)-(3-bromophenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | COc1ccccc1CN/N=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C15H15BrN2O/c1-19-15-8-3-2-6-13(15)11-18-17-10-12-5-4-7-14(16)9-12/h2-10,18H,11H2,1H3/b17-10+ |
| InChIKey | DJFRYYJJPATELJ-LICLKQGHSA-N |
| XLogP | 3.58 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|