C17H20BrN3O — CID 29147760
2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline (PubChem CID 29147760) has the molecular formula C17H20BrN3O and a molecular weight of 362.27 g/mol. Its IUPAC name is 2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 29147760 |
| Molecular Formula | C17H20BrN3O |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]-N,N-dimethylaniline |
| SMILES | COc1ccccc1CN/N=C\c1ccc(N(C)C)c(Br)c1 |
| InChI | InChI=1S/C17H20BrN3O/c1-21(2)16-9-8-13(10-15(16)18)11-19-20-12-14-6-4-5-7-17(14)22-3/h4-11,20H,12H2,1-3H3/b19-11- |
| InChIKey | RLCJRGVXNNJZSL-ODLFYWEKSA-N |
| XLogP | 3.65 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|