C23H20BrN3O2 — CID 29147479
2-[[2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 29147479) has the molecular formula C23H20BrN3O2 and a molecular weight of 450.34 g/mol. Its IUPAC name is 2-[[2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 29147479 |
| Molecular Formula | C23H20BrN3O2 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[[2-bromo-4-[(Z)-[(2-methoxyphenyl)methylhydrazinylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1ccccc1CN/N=C\c1ccc(OCc2ccccc2C#N)c(Br)c1 |
| InChI | InChI=1S/C23H20BrN3O2/c1-28-22-9-5-4-7-19(22)15-27-26-14-17-10-11-23(21(24)12-17)29-16-20-8-3-2-6-18(20)13-25/h2-12,14,27H,15-16H2,1H3/b26-14- |
| InChIKey | LIMLCTVJSQBAIM-WGARJPEWSA-N |
| XLogP | 5.03 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|