C25H28BrN3O8 — CID 3620505
ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetate (PubChem CID 3620505) has the molecular formula C25H28BrN3O8 and a molecular weight of 578.42 g/mol. Its IUPAC name is ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3620505 |
| Molecular Formula | C25H28BrN3O8 |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | ethyl 2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-bromo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=NNC(=O)C(NC(=O)c2ccc3c(c2)OCO3)C(C)C)cc1OC |
| InChI | InChI=1S/C25H28BrN3O8/c1-5-34-21(30)12-35-23-17(26)8-15(9-20(23)33-4)11-27-29-25(32)22(14(2)3)28-24(31)16-6-7-18-19(10-16)37-13-36-18/h6-11,14,22H,5,12-13H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | KNOPOPPNGWDHBZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|