C33H36N4O9 — CID 5196976
ethyl 4-[[2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate (PubChem CID 5196976) has the molecular formula C33H36N4O9 and a molecular weight of 632.67 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 5196976 |
| Molecular Formula | C33H36N4O9 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | ethyl 4-[[2-[4-[[[2-(1,3-benzodioxole-5-carbonylamino)-3-methylbutanoyl]hydrazinylidene]methyl]-2-ethoxyphenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(C=NNC(=O)C(NC(=O)c3ccc4c(c3)OCO4)C(C)C)cc2OCC)cc1 |
| InChI | InChI=1S/C33H36N4O9/c1-5-42-27-15-21(7-13-25(27)44-18-29(38)35-24-11-8-22(9-12-24)33(41)43-6-2)17-34-37-32(40)30(20(3)4)36-31(39)23-10-14-26-28(16-23)46-19-45-26/h7-17,20,30H,5-6,18-19H2,1-4H3,(H,35,38)(H,36,39)(H,37,40) |
| InChIKey | HPGQOHFGYLHPDC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|