C22H23ClN4O6 — CID 3980906
N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3980906) has the molecular formula C22H23ClN4O6 and a molecular weight of 474.90 g/mol. Its IUPAC name is N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3980906 |
| Molecular Formula | C22H23ClN4O6 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-[1-[2-[[2-(2-amino-2-oxoethoxy)-5-chlorophenyl]methylidene]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc2c(c1)OCO2)C(=O)NN=Cc1cc(Cl)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H23ClN4O6/c1-12(2)20(26-21(29)13-3-5-17-18(8-13)33-11-32-17)22(30)27-25-9-14-7-15(23)4-6-16(14)31-10-19(24)28/h3-9,12,20H,10-11H2,1-2H3,(H2,24,28)(H,26,29)(H,27,30) |
| InChIKey | KTZVRVYWHWBYKQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|