C16H14ClNO3 — CID 4251208
3-(1,3-benzodioxol-5-ylamino)-1-(4-chlorophenyl)propan-1-one (PubChem CID 4251208) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-1-(4-chlorophenyl)propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-1-(4-chlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 4251208 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-1-(4-chlorophenyl)propan-1-one |
| SMILES | O=C(CCNc1ccc2c(c1)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClNO3/c17-12-3-1-11(2-4-12)14(19)7-8-18-13-5-6-15-16(9-13)21-10-20-15/h1-6,9,18H,7-8,10H2 |
| InChIKey | WBHXJGGATWLMRC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|