C22H25NO3 — CID 5111491
1-(1,3-benzodioxol-5-yl)-3-(4-cyclohexylanilino)propan-1-one (PubChem CID 5111491) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(4-cyclohexylanilino)propan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(4-cyclohexylanilino)propan-1-one |
|---|---|
| PubChem CID | 5111491 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(4-cyclohexylanilino)propan-1-one |
| SMILES | O=C(CCNc1ccc(C2CCCCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H25NO3/c24-20(18-8-11-21-22(14-18)26-15-25-21)12-13-23-19-9-6-17(7-10-19)16-4-2-1-3-5-16/h6-11,14,16,23H,1-5,12-13,15H2 |
| InChIKey | BLQVQMILAVHJIM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |