C11H11NO3S — CID 82083843
4-(1,3-benzodioxol-5-yl)-4-oxobutanethioamide (PubChem CID 82083843) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-4-oxobutanethioamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-4-oxobutanethioamide |
|---|---|
| PubChem CID | 82083843 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-4-oxobutanethioamide |
| SMILES | NC(=S)CCC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H11NO3S/c12-11(16)4-2-8(13)7-1-3-9-10(5-7)15-6-14-9/h1,3,5H,2,4,6H2,(H2,12,16) |
| InChIKey | NTWWVHIIKGZCLE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|