C16H9F5O3S — CID 3682586
1-(1,3-benzodioxol-5-yl)-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpropan-1-one (PubChem CID 3682586) has the molecular formula C16H9F5O3S and a molecular weight of 376.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpropan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 3682586 |
| Molecular Formula | C16H9F5O3S |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(2,3,4,5,6-pentafluorophenyl)sulfanylpropan-1-one |
| SMILES | O=C(CCSc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H9F5O3S/c17-11-12(18)14(20)16(15(21)13(11)19)25-4-3-8(22)7-1-2-9-10(5-7)24-6-23-9/h1-2,5H,3-4,6H2 |
| InChIKey | NRCBAXZLIFQQQF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|